C20H26N2O — CID 143044176
3-(2-aminoethyl)-4-ethyl-N-(3-phenylpropyl)benzamide (PubChem CID 143044176) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-(2-aminoethyl)-4-ethyl-N-(3-phenylpropyl)benzamide.
| Compound Name | 3-(2-aminoethyl)-4-ethyl-N-(3-phenylpropyl)benzamide |
|---|---|
| PubChem CID | 143044176 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 3-(2-aminoethyl)-4-ethyl-N-(3-phenylpropyl)benzamide |
| SMILES | CCc1ccc(C(=O)NCCCc2ccccc2)cc1CCN |
| InChI | InChI=1S/C20H26N2O/c1-2-17-10-11-19(15-18(17)12-13-21)20(23)22-14-6-9-16-7-4-3-5-8-16/h3-5,7-8,10-11,15H,2,6,9,12-14,21H2,1H3,(H,22,23) |
| InChIKey | ZXAQJZLCUGVMIO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|