C27H22N4O6S — CID 142082839
2-[3-(1-aminoethenyl)phenoxy]-5-nitro-N-[4-(2-sulfamoylphenyl)phenyl]benzamide (PubChem CID 142082839) has the molecular formula C27H22N4O6S and a molecular weight of 530.56 g/mol. Its IUPAC name is 2-[3-(1-aminoethenyl)phenoxy]-5-nitro-N-[4-(2-sulfamoylphenyl)phenyl]benzamide.
| Compound Name | 2-[3-(1-aminoethenyl)phenoxy]-5-nitro-N-[4-(2-sulfamoylphenyl)phenyl]benzamide |
|---|---|
| PubChem CID | 142082839 |
| Molecular Formula | C27H22N4O6S |
| Molecular Weight | 530.56 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 2-[3-(1-aminoethenyl)phenoxy]-5-nitro-N-[4-(2-sulfamoylphenyl)phenyl]benzamide |
| SMILES | C=C(N)c1cccc(Oc2ccc([N+](=O)[O-])cc2C(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C27H22N4O6S/c1-17(28)19-5-4-6-22(15-19)37-25-14-13-21(31(33)34)16-24(25)27(32)30-20-11-9-18(10-12-20)23-7-2-3-8-26(23)38(29,35)36/h2-16H,1,28H2,(H,30,32)(H2,29,35,36) |
| InChIKey | KIYROUXDGGPMOV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 167.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|