C30H28N4O6S — CID 142083486
2-[1-[3-[1-(hydroxyamino)ethenyl]phenyl]propyl]-5-nitro-N-[4-(2-sulfamoylphenyl)phenyl]benzamide (PubChem CID 142083486) has the molecular formula C30H28N4O6S and a molecular weight of 572.64 g/mol. Its IUPAC name is 2-[1-[3-[1-(hydroxyamino)ethenyl]phenyl]propyl]-5-nitro-N-[4-(2-sulfamoylphenyl)phenyl]benzamide.
| Compound Name | 2-[1-[3-[1-(hydroxyamino)ethenyl]phenyl]propyl]-5-nitro-N-[4-(2-sulfamoylphenyl)phenyl]benzamide |
|---|---|
| PubChem CID | 142083486 |
| Molecular Formula | C30H28N4O6S |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | 2-[1-[3-[1-(hydroxyamino)ethenyl]phenyl]propyl]-5-nitro-N-[4-(2-sulfamoylphenyl)phenyl]benzamide |
| SMILES | C=C(NO)c1cccc(C(CC)c2ccc([N+](=O)[O-])cc2C(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C30H28N4O6S/c1-3-25(22-8-6-7-21(17-22)19(2)33-36)27-16-15-24(34(37)38)18-28(27)30(35)32-23-13-11-20(12-14-23)26-9-4-5-10-29(26)41(31,39)40/h4-18,25,33,36H,2-3H2,1H3,(H,32,35)(H2,31,39,40) |
| InChIKey | JBYHXRVWMQQDTC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 164.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|