C25H20ClN3O6 — CID 139962950
2-chloro-N-[4-[2-(1,3-dioxoisoindol-2-yl)butoxy]phenyl]-5-nitrobenzamide (PubChem CID 139962950) has the molecular formula C25H20ClN3O6 and a molecular weight of 493.90 g/mol. Its IUPAC name is 2-chloro-N-[4-[2-(1,3-dioxoisoindol-2-yl)butoxy]phenyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[4-[2-(1,3-dioxoisoindol-2-yl)butoxy]phenyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 139962950 |
| Molecular Formula | C25H20ClN3O6 |
| Molecular Weight | 493.90 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 2-chloro-N-[4-[2-(1,3-dioxoisoindol-2-yl)butoxy]phenyl]-5-nitrobenzamide |
| SMILES | CCC(COc1ccc(NC(=O)c2cc([N+](=O)[O-])ccc2Cl)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H20ClN3O6/c1-2-16(28-24(31)19-5-3-4-6-20(19)25(28)32)14-35-18-10-7-15(8-11-18)27-23(30)21-13-17(29(33)34)9-12-22(21)26/h3-13,16H,2,14H2,1H3,(H,27,30) |
| InChIKey | NNCSTQNSMRLLEO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.90 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|