C21H18ClN3O6S — CID 17147139
2-chloro-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-5-nitrobenzamide (PubChem CID 17147139) has the molecular formula C21H18ClN3O6S and a molecular weight of 475.91 g/mol. Its IUPAC name is 2-chloro-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 17147139 |
| Molecular Formula | C21H18ClN3O6S |
| Molecular Weight | 475.91 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | 2-chloro-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-5-nitrobenzamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(NC(=O)c3cc([N+](=O)[O-])ccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C21H18ClN3O6S/c1-2-31-17-8-3-15(4-9-17)24-32(29,30)18-10-5-14(6-11-18)23-21(26)19-13-16(25(27)28)7-12-20(19)22/h3-13,24H,2H2,1H3,(H,23,26) |
| InChIKey | SHRLWVOMRVBRGH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.91 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|