C26H21N5O7S — CID 73460716
2-[3-(N'-hydroxycarbamimidoyl)phenoxy]-5-nitro-N-[4-(2-sulfamoylphenyl)phenyl]benzamide (PubChem CID 73460716) has the molecular formula C26H21N5O7S and a molecular weight of 547.55 g/mol. Its IUPAC name is 2-[3-(N'-hydroxycarbamimidoyl)phenoxy]-5-nitro-N-[4-(2-sulfamoylphenyl)phenyl]benzamide.
| Compound Name | 2-[3-(N'-hydroxycarbamimidoyl)phenoxy]-5-nitro-N-[4-(2-sulfamoylphenyl)phenyl]benzamide |
|---|---|
| PubChem CID | 73460716 |
| Molecular Formula | C26H21N5O7S |
| Molecular Weight | 547.55 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | 2-[3-(N'-hydroxycarbamimidoyl)phenoxy]-5-nitro-N-[4-(2-sulfamoylphenyl)phenyl]benzamide |
| SMILES | NC(=NO)c1cccc(Oc2ccc([N+](=O)[O-])cc2C(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C26H21N5O7S/c27-25(30-33)17-4-3-5-20(14-17)38-23-13-12-19(31(34)35)15-22(23)26(32)29-18-10-8-16(9-11-18)21-6-1-2-7-24(21)39(28,36)37/h1-15,33H,(H2,27,30)(H,29,32)(H2,28,36,37) |
| InChIKey | FYHPDCMZXYCBEM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 200.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|