C22H28N2O2 — CID 7946952
4-tert-butyl-N-[3-(2,3-dimethylanilino)-3-oxopropyl]benzamide (PubChem CID 7946952) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-(2,3-dimethylanilino)-3-oxopropyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-(2,3-dimethylanilino)-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 7946952 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 4-tert-butyl-N-[3-(2,3-dimethylanilino)-3-oxopropyl]benzamide |
| SMILES | Cc1cccc(NC(=O)CCNC(=O)c2ccc(C(C)(C)C)cc2)c1C |
| InChI | InChI=1S/C22H28N2O2/c1-15-7-6-8-19(16(15)2)24-20(25)13-14-23-21(26)17-9-11-18(12-10-17)22(3,4)5/h6-12H,13-14H2,1-5H3,(H,23,26)(H,24,25) |
| InChIKey | GUGXNLPKXJUNLU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |