C18H21N3O2 — CID 54846384
4-[[2-(2,3-dimethylanilino)-2-oxoethyl]amino]-N-methylbenzamide (PubChem CID 54846384) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 4-[[2-(2,3-dimethylanilino)-2-oxoethyl]amino]-N-methylbenzamide.
| Compound Name | 4-[[2-(2,3-dimethylanilino)-2-oxoethyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 54846384 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 4-[[2-(2,3-dimethylanilino)-2-oxoethyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NCC(=O)Nc2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C18H21N3O2/c1-12-5-4-6-16(13(12)2)21-17(22)11-20-15-9-7-14(8-10-15)18(23)19-3/h4-10,20H,11H2,1-3H3,(H,19,23)(H,21,22) |
| InChIKey | BZDJPDKNWZNEKE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |