C9H12ClN3O3S — CID 14868379
1-(2-chloroethyl)-3-(2-sulfamoylphenyl)urea (PubChem CID 14868379) has the molecular formula C9H12ClN3O3S and a molecular weight of 277.73 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-(2-sulfamoylphenyl)urea.
| Compound Name | 1-(2-chloroethyl)-3-(2-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 14868379 |
| Molecular Formula | C9H12ClN3O3S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 1-(2-chloroethyl)-3-(2-sulfamoylphenyl)urea |
| SMILES | NS(=O)(=O)c1ccccc1NC(=O)NCCCl |
| InChI | InChI=1S/C9H12ClN3O3S/c10-5-6-12-9(14)13-7-3-1-2-4-8(7)17(11,15)16/h1-4H,5-6H2,(H2,11,15,16)(H2,12,13,14) |
| InChIKey | LGSLNZAFWGVMOO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|