C19H17N3O3S — CID 3622343
1,1-diphenyl-3-(2-sulfamoylphenyl)urea (PubChem CID 3622343) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is 1,1-diphenyl-3-(2-sulfamoylphenyl)urea.
| Compound Name | 1,1-diphenyl-3-(2-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 3622343 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 1,1-diphenyl-3-(2-sulfamoylphenyl)urea |
| SMILES | NS(=O)(=O)c1ccccc1NC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17N3O3S/c20-26(24,25)18-14-8-7-13-17(18)21-19(23)22(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H,(H,21,23)(H2,20,24,25) |
| InChIKey | OGLWLXHYZCDFOP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |