C21H20FN3O3S — CID 122179678
1-(2-fluoro-3,6-dimethylphenyl)-1-phenyl-3-(2-sulfamoylphenyl)urea (PubChem CID 122179678) has the molecular formula C21H20FN3O3S and a molecular weight of 413.47 g/mol. Its IUPAC name is 1-(2-fluoro-3,6-dimethylphenyl)-1-phenyl-3-(2-sulfamoylphenyl)urea.
| Compound Name | 1-(2-fluoro-3,6-dimethylphenyl)-1-phenyl-3-(2-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 122179678 |
| Molecular Formula | C21H20FN3O3S |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 1-(2-fluoro-3,6-dimethylphenyl)-1-phenyl-3-(2-sulfamoylphenyl)urea |
| SMILES | Cc1ccc(C)c(N(C(=O)Nc2ccccc2S(N)(=O)=O)c2ccccc2)c1F |
| InChI | InChI=1S/C21H20FN3O3S/c1-14-12-13-15(2)20(19(14)22)25(16-8-4-3-5-9-16)21(26)24-17-10-6-7-11-18(17)29(23,27)28/h3-13H,1-2H3,(H,24,26)(H2,23,27,28) |
| InChIKey | XYDPXCTULKXYFN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |