C8H9ClN2O4S — CID 15029588
2-chloro-N-(2-hydroxy-3-sulfamoylphenyl)acetamide (PubChem CID 15029588) has the molecular formula C8H9ClN2O4S and a molecular weight of 264.69 g/mol. Its IUPAC name is 2-chloro-N-(2-hydroxy-3-sulfamoylphenyl)acetamide.
| Compound Name | 2-chloro-N-(2-hydroxy-3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 15029588 |
| Molecular Formula | C8H9ClN2O4S |
| Molecular Weight | 264.69 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 2-chloro-N-(2-hydroxy-3-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)CCl)c1O |
| InChI | InChI=1S/C8H9ClN2O4S/c9-4-7(12)11-5-2-1-3-6(8(5)13)16(10,14)15/h1-3,13H,4H2,(H,11,12)(H2,10,14,15) |
| InChIKey | NDBAJZSQKMGDOB-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.69 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|