C16H14Cl2N4O8S2 — CID 71403677
2-[(2-chloroacetyl)amino]-5-[[4-[(2-chloroacetyl)amino]-3-sulfophenyl]diazenyl]benzenesulfonic acid (PubChem CID 71403677) has the molecular formula C16H14Cl2N4O8S2 and a molecular weight of 525.35 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)amino]-5-[[4-[(2-chloroacetyl)amino]-3-sulfophenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2-[(2-chloroacetyl)amino]-5-[[4-[(2-chloroacetyl)amino]-3-sulfophenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 71403677 |
| Molecular Formula | C16H14Cl2N4O8S2 |
| Molecular Weight | 525.35 g/mol |
| Exact Mass | 523.96 |
| IUPAC Name | 2-[(2-chloroacetyl)amino]-5-[[4-[(2-chloroacetyl)amino]-3-sulfophenyl]diazenyl]benzenesulfonic acid |
| SMILES | O=C(CCl)Nc1ccc(/N=N/c2ccc(NC(=O)CCl)c(S(=O)(=O)O)c2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C16H14Cl2N4O8S2/c17-7-15(23)19-11-3-1-9(5-13(11)31(25,26)27)21-22-10-2-4-12(20-16(24)8-18)14(6-10)32(28,29)30/h1-6H,7-8H2,(H,19,23)(H,20,24)(H,25,26,27)(H,28,29,30)/b22-21+ |
| InChIKey | XGDZZBFDOAZUPI-QURGRASLSA-N |
| XLogP | 2.95 |
| TPSA | 191.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|