C26H23N5O7S2 — CID 143586589
2-[[4-[(4-hydroxy-3-methylphenyl)diazenyl]phenyl]methylamino]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid (PubChem CID 143586589) has the molecular formula C26H23N5O7S2 and a molecular weight of 581.63 g/mol. Its IUPAC name is 2-[[4-[(4-hydroxy-3-methylphenyl)diazenyl]phenyl]methylamino]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[4-[(4-hydroxy-3-methylphenyl)diazenyl]phenyl]methylamino]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 143586589 |
| Molecular Formula | C26H23N5O7S2 |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 581.10 |
| IUPAC Name | 2-[[4-[(4-hydroxy-3-methylphenyl)diazenyl]phenyl]methylamino]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
| SMILES | Cc1cc(/N=N/c2ccc(CNc3ccc(/N=N/c4ccc(S(=O)(=O)O)cc4)cc3S(=O)(=O)O)cc2)ccc1O |
| InChI | InChI=1S/C26H23N5O7S2/c1-17-14-21(9-13-25(17)32)30-28-19-4-2-18(3-5-19)16-27-24-12-8-22(15-26(24)40(36,37)38)31-29-20-6-10-23(11-7-20)39(33,34)35/h2-15,27,32H,16H2,1H3,(H,33,34,35)(H,36,37,38)/b30-28+,31-29+ |
| InChIKey | PHAFHECORBHUDV-FUEWEDNTSA-N |
| XLogP | 6.64 |
| TPSA | 190.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|