C21H17N3O7S2 — CID 153235539
2-[[(E)-3-phenylprop-2-enoyl]amino]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid (PubChem CID 153235539) has the molecular formula C21H17N3O7S2 and a molecular weight of 487.52 g/mol. Its IUPAC name is 2-[[(E)-3-phenylprop-2-enoyl]amino]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[(E)-3-phenylprop-2-enoyl]amino]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 153235539 |
| Molecular Formula | C21H17N3O7S2 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | 2-[[(E)-3-phenylprop-2-enoyl]amino]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
| SMILES | O=C(/C=C/c1ccccc1)Nc1ccc(/N=N/c2ccc(S(=O)(=O)O)cc2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C21H17N3O7S2/c25-21(13-6-15-4-2-1-3-5-15)22-19-12-9-17(14-20(19)33(29,30)31)24-23-16-7-10-18(11-8-16)32(26,27)28/h1-14H,(H,22,25)(H,26,27,28)(H,29,30,31)/b13-6+,24-23+ |
| InChIKey | WQKIDXKVAQAGLK-JUCFTTQOSA-N |
| XLogP | 4.25 |
| TPSA | 162.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|