C16H16N4O8S4 — CID 56940697
2-[(2-sulfanylacetyl)amino]-5-[[4-[(2-sulfanylacetyl)amino]-3-sulfophenyl]diazenyl]benzenesulfonic acid (PubChem CID 56940697) has the molecular formula C16H16N4O8S4 and a molecular weight of 520.59 g/mol. Its IUPAC name is 2-[(2-sulfanylacetyl)amino]-5-[[4-[(2-sulfanylacetyl)amino]-3-sulfophenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2-[(2-sulfanylacetyl)amino]-5-[[4-[(2-sulfanylacetyl)amino]-3-sulfophenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 56940697 |
| Molecular Formula | C16H16N4O8S4 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 519.99 |
| IUPAC Name | 2-[(2-sulfanylacetyl)amino]-5-[[4-[(2-sulfanylacetyl)amino]-3-sulfophenyl]diazenyl]benzenesulfonic acid |
| SMILES | O=C(CS)Nc1ccc(/N=N/c2ccc(NC(=O)CS)c(S(=O)(=O)O)c2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C16H16N4O8S4/c21-15(7-29)17-11-3-1-9(5-13(11)31(23,24)25)19-20-10-2-4-12(18-16(22)8-30)14(6-10)32(26,27)28/h1-6,29-30H,7-8H2,(H,17,21)(H,18,22)(H,23,24,25)(H,26,27,28)/b20-19+ |
| InChIKey | VSTJBQDHDCDXPD-FMQUCBEESA-N |
| XLogP | 2.33 |
| TPSA | 191.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|