C12H14Br2N2O5S — CID 20688338
2,5-bis(3-bromopropanoylamino)benzenesulfonic acid (PubChem CID 20688338) has the molecular formula C12H14Br2N2O5S and a molecular weight of 458.13 g/mol. Its IUPAC name is 2,5-bis(3-bromopropanoylamino)benzenesulfonic acid.
| Compound Name | 2,5-bis(3-bromopropanoylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 20688338 |
| Molecular Formula | C12H14Br2N2O5S |
| Molecular Weight | 458.13 g/mol |
| Exact Mass | 455.90 |
| IUPAC Name | 2,5-bis(3-bromopropanoylamino)benzenesulfonic acid |
| SMILES | O=C(CCBr)Nc1ccc(NC(=O)CCBr)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C12H14Br2N2O5S/c13-5-3-11(17)15-8-1-2-9(16-12(18)4-6-14)10(7-8)22(19,20)21/h1-2,7H,3-6H2,(H,15,17)(H,16,18)(H,19,20,21) |
| InChIKey | AQMGJNFUXUJJQY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.13 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|