C18H16N2O8S4 — CID 118797866
5-[(2-sulfanylacetyl)amino]-2-[2-[4-[(2-sulfanylacetyl)amino]-2-sulfophenyl]ethynyl]benzenesulfonic acid (PubChem CID 118797866) has the molecular formula C18H16N2O8S4 and a molecular weight of 516.60 g/mol. Its IUPAC name is 5-[(2-sulfanylacetyl)amino]-2-[2-[4-[(2-sulfanylacetyl)amino]-2-sulfophenyl]ethynyl]benzenesulfonic acid.
| Compound Name | 5-[(2-sulfanylacetyl)amino]-2-[2-[4-[(2-sulfanylacetyl)amino]-2-sulfophenyl]ethynyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 118797866 |
| Molecular Formula | C18H16N2O8S4 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 515.98 |
| IUPAC Name | 5-[(2-sulfanylacetyl)amino]-2-[2-[4-[(2-sulfanylacetyl)amino]-2-sulfophenyl]ethynyl]benzenesulfonic acid |
| SMILES | O=C(CS)Nc1ccc(C#Cc2ccc(NC(=O)CS)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H16N2O8S4/c21-17(9-29)19-13-5-3-11(15(7-13)31(23,24)25)1-2-12-4-6-14(20-18(22)10-30)8-16(12)32(26,27)28/h3-8,29-30H,9-10H2,(H,19,21)(H,20,22)(H,23,24,25)(H,26,27,28) |
| InChIKey | JJKLQPGJBGOQAZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|