C8H8KNO4S2 — CID 88792050
potassium 3-[(2-sulfanylacetyl)amino]benzenesulfonate (PubChem CID 88792050) has the molecular formula C8H8KNO4S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is potassium 3-[(2-sulfanylacetyl)amino]benzenesulfonate.
| Compound Name | potassium 3-[(2-sulfanylacetyl)amino]benzenesulfonate |
|---|---|
| PubChem CID | 88792050 |
| Molecular Formula | C8H8KNO4S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 284.95 |
| IUPAC Name | potassium 3-[(2-sulfanylacetyl)amino]benzenesulfonate |
| SMILES | O=C(CS)Nc1cccc(S(=O)(=O)[O-])c1.[K+] |
| InChI | InChI=1S/C8H9NO4S2.K/c10-8(5-14)9-6-2-1-3-7(4-6)15(11,12)13;/h1-4,14H,5H2,(H,9,10)(H,11,12,13);/q;+1/p-1 |
| InChIKey | MAPUHHCFECBUQP-UHFFFAOYSA-M |
| XLogP | -2.54 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|