C11H15NO4S — CID 79193203
4-hydroxy-N-(3-methylsulfonylphenyl)butanamide (PubChem CID 79193203) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is 4-hydroxy-N-(3-methylsulfonylphenyl)butanamide.
| Compound Name | 4-hydroxy-N-(3-methylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 79193203 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-hydroxy-N-(3-methylsulfonylphenyl)butanamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)CCCO)c1 |
| InChI | InChI=1S/C11H15NO4S/c1-17(15,16)10-5-2-4-9(8-10)12-11(14)6-3-7-13/h2,4-5,8,13H,3,6-7H2,1H3,(H,12,14) |
| InChIKey | WZSNVQGPPIBZAV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |