C13H20N2O3S — CID 54862201
N-(3-methylsulfonylphenyl)-3-(propan-2-ylamino)propanamide (PubChem CID 54862201) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is N-(3-methylsulfonylphenyl)-3-(propan-2-ylamino)propanamide.
| Compound Name | N-(3-methylsulfonylphenyl)-3-(propan-2-ylamino)propanamide |
|---|---|
| PubChem CID | 54862201 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-(3-methylsulfonylphenyl)-3-(propan-2-ylamino)propanamide |
| SMILES | CC(C)NCCC(=O)Nc1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H20N2O3S/c1-10(2)14-8-7-13(16)15-11-5-4-6-12(9-11)19(3,17)18/h4-6,9-10,14H,7-8H2,1-3H3,(H,15,16) |
| InChIKey | JGEVNPVEUVBXMS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |