C19H20N2NaO9S2+ — CID 71486826
sodium 5-acetamido-2-[(E)-2-[4-[(2-methoxyacetyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 71486826) has the molecular formula C19H20N2NaO9S2+ and a molecular weight of 507.50 g/mol. Its IUPAC name is sodium 5-acetamido-2-[(E)-2-[4-[(2-methoxyacetyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | sodium 5-acetamido-2-[(E)-2-[4-[(2-methoxyacetyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 71486826 |
| Molecular Formula | C19H20N2NaO9S2+ |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | sodium 5-acetamido-2-[(E)-2-[4-[(2-methoxyacetyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | COCC(=O)Nc1ccc(/C=C/c2ccc(NC(C)=O)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1.[Na+] |
| InChI | InChI=1S/C19H20N2O9S2.Na/c1-12(22)20-15-7-5-13(17(9-15)31(24,25)26)3-4-14-6-8-16(21-19(23)11-30-2)10-18(14)32(27,28)29;/h3-10H,11H2,1-2H3,(H,20,22)(H,21,23)(H,24,25,26)(H,27,28,29);/q;+1/b4-3+; |
| InChIKey | BGEIJNAOAZRSOB-BJILWQEISA-N |
| XLogP | -1.10 |
| TPSA | 176.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|