C20H16N2O9S2 — CID 6449851
5-acetamido-2-[(E)-2-[4-(2,5-dioxopyrrol-1-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 6449851) has the molecular formula C20H16N2O9S2 and a molecular weight of 492.49 g/mol. Its IUPAC name is 5-acetamido-2-[(E)-2-[4-(2,5-dioxopyrrol-1-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-acetamido-2-[(E)-2-[4-(2,5-dioxopyrrol-1-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 6449851 |
| Molecular Formula | C20H16N2O9S2 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | 5-acetamido-2-[(E)-2-[4-(2,5-dioxopyrrol-1-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | CC(=O)Nc1ccc(/C=C/c2ccc(N3C(=O)C=CC3=O)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C20H16N2O9S2/c1-12(23)21-15-6-4-13(17(10-15)32(26,27)28)2-3-14-5-7-16(11-18(14)33(29,30)31)22-19(24)8-9-20(22)25/h2-11H,1H3,(H,21,23)(H,26,27,28)(H,29,30,31)/b3-2+ |
| InChIKey | VVMKDNFTYDHDJS-NSCUHMNNSA-N |
| XLogP | 1.74 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|