C21H28N2O3S — CID 157478977
2-[(E)-2-[2-methyl-4-(propan-2-ylamino)phenyl]ethenyl]-5-(propan-2-ylamino)benzenesulfonic acid (PubChem CID 157478977) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is 2-[(E)-2-[2-methyl-4-(propan-2-ylamino)phenyl]ethenyl]-5-(propan-2-ylamino)benzenesulfonic acid.
| Compound Name | 2-[(E)-2-[2-methyl-4-(propan-2-ylamino)phenyl]ethenyl]-5-(propan-2-ylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 157478977 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-[(E)-2-[2-methyl-4-(propan-2-ylamino)phenyl]ethenyl]-5-(propan-2-ylamino)benzenesulfonic acid |
| SMILES | Cc1cc(NC(C)C)ccc1/C=C/c1ccc(NC(C)C)cc1S(=O)(=O)O |
| InChI | InChI=1S/C21H28N2O3S/c1-14(2)22-19-10-8-17(16(5)12-19)6-7-18-9-11-20(23-15(3)4)13-21(18)27(24,25)26/h6-15,22-23H,1-5H3,(H,24,25,26)/b7-6+ |
| InChIKey | NLPKDJKJEXNGBW-VOTSOKGWSA-N |
| XLogP | 5.05 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|