C18H20N4O6S4 — CID 173494962
5-(methylcarbamothioylamino)-2-[2-[4-(methylcarbamothioylamino)-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 173494962) has the molecular formula C18H20N4O6S4 and a molecular weight of 516.65 g/mol. Its IUPAC name is 5-(methylcarbamothioylamino)-2-[2-[4-(methylcarbamothioylamino)-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-(methylcarbamothioylamino)-2-[2-[4-(methylcarbamothioylamino)-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 173494962 |
| Molecular Formula | C18H20N4O6S4 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.03 |
| IUPAC Name | 5-(methylcarbamothioylamino)-2-[2-[4-(methylcarbamothioylamino)-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | CNC(=S)Nc1ccc(C=Cc2ccc(NC(=S)NC)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H20N4O6S4/c1-19-17(29)21-13-7-5-11(15(9-13)31(23,24)25)3-4-12-6-8-14(22-18(30)20-2)10-16(12)32(26,27)28/h3-10H,1-2H3,(H2,19,21,29)(H2,20,22,30)(H,23,24,25)(H,26,27,28) |
| InChIKey | GRQHHFOVULZAFS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|