C21H18N2O3S2 — CID 169358858
5-(carbamothioylamino)-2-[2-(4-phenylphenyl)ethenyl]benzenesulfonic acid (PubChem CID 169358858) has the molecular formula C21H18N2O3S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 5-(carbamothioylamino)-2-[2-(4-phenylphenyl)ethenyl]benzenesulfonic acid.
| Compound Name | 5-(carbamothioylamino)-2-[2-(4-phenylphenyl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 169358858 |
| Molecular Formula | C21H18N2O3S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 5-(carbamothioylamino)-2-[2-(4-phenylphenyl)ethenyl]benzenesulfonic acid |
| SMILES | NC(=S)Nc1ccc(C=Cc2ccc(-c3ccccc3)cc2)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C21H18N2O3S2/c22-21(27)23-19-13-12-18(20(14-19)28(24,25)26)11-8-15-6-9-17(10-7-15)16-4-2-1-3-5-16/h1-14H,(H3,22,23,27)(H,24,25,26) |
| InChIKey | UYHMZNQEYDSNPS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|