C35H26F2O2S — CID 5175611
2-(difluoromethylsulfonyl)-1,4-bis[2-(4-phenylphenyl)ethenyl]benzene (PubChem CID 5175611) has the molecular formula C35H26F2O2S and a molecular weight of 548.65 g/mol. Its IUPAC name is 2-(difluoromethylsulfonyl)-1,4-bis[2-(4-phenylphenyl)ethenyl]benzene.
| Compound Name | 2-(difluoromethylsulfonyl)-1,4-bis[2-(4-phenylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 5175611 |
| Molecular Formula | C35H26F2O2S |
| Molecular Weight | 548.65 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | 2-(difluoromethylsulfonyl)-1,4-bis[2-(4-phenylphenyl)ethenyl]benzene |
| SMILES | O=S(=O)(c1cc(C=Cc2ccc(-c3ccccc3)cc2)ccc1C=Cc1ccc(-c2ccccc2)cc1)C(F)F |
| InChI | InChI=1S/C35H26F2O2S/c36-35(37)40(38,39)34-25-28(12-11-26-13-19-31(20-14-26)29-7-3-1-4-8-29)18-24-33(34)23-17-27-15-21-32(22-16-27)30-9-5-2-6-10-30/h1-25,35H |
| InChIKey | IPBIOHSNFIMWGU-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.65 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|