C42H34B2O10S2 — CID 102148843
5-[4-[(E)-2-(4-boronophenyl)ethenyl]phenyl]-2-[(E)-2-[4-[4-[(E)-2-(4-boronophenyl)ethenyl]phenyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 102148843) has the molecular formula C42H34B2O10S2 and a molecular weight of 784.48 g/mol. Its IUPAC name is 5-[4-[(E)-2-(4-boronophenyl)ethenyl]phenyl]-2-[(E)-2-[4-[4-[(E)-2-(4-boronophenyl)ethenyl]phenyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-[4-[(E)-2-(4-boronophenyl)ethenyl]phenyl]-2-[(E)-2-[4-[4-[(E)-2-(4-boronophenyl)ethenyl]phenyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 102148843 |
| Molecular Formula | C42H34B2O10S2 |
| Molecular Weight | 784.48 g/mol |
| Exact Mass | 784.18 |
| IUPAC Name | 5-[4-[(E)-2-(4-boronophenyl)ethenyl]phenyl]-2-[(E)-2-[4-[4-[(E)-2-(4-boronophenyl)ethenyl]phenyl]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(-c2ccc(/C=C/c3ccc(B(O)O)cc3)cc2)ccc1/C=C/c1ccc(-c2ccc(/C=C/c3ccc(B(O)O)cc3)cc2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C42H34B2O10S2/c45-43(46)39-23-9-31(10-24-39)3-1-29-5-13-33(14-6-29)37-21-19-35(41(27-37)55(49,50)51)17-18-36-20-22-38(28-42(36)56(52,53)54)34-15-7-30(8-16-34)2-4-32-11-25-40(26-12-32)44(47)48/h1-28,45-48H,(H,49,50,51)(H,52,53,54)/b3-1+,4-2+,18-17+ |
| InChIKey | GETNNQLTTRAJOC-XWTATMHRSA-N |
| XLogP | 5.38 |
| TPSA | 189.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|