C28H22O3S — CID 58971886
2-[2-[4-[4-(2-phenylethenyl)phenyl]phenyl]ethenyl]benzenesulfonic acid (PubChem CID 58971886) has the molecular formula C28H22O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is 2-[2-[4-[4-(2-phenylethenyl)phenyl]phenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 2-[2-[4-[4-(2-phenylethenyl)phenyl]phenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 58971886 |
| Molecular Formula | C28H22O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2-[2-[4-[4-(2-phenylethenyl)phenyl]phenyl]ethenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccccc1C=Cc1ccc(-c2ccc(C=Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H22O3S/c29-32(30,31)28-9-5-4-8-27(28)21-16-24-14-19-26(20-15-24)25-17-12-23(13-18-25)11-10-22-6-2-1-3-7-22/h1-21H,(H,29,30,31) |
| InChIKey | SWRMMYCMHSMLDN-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|