C28H21ClO3S — CID 131989084
2-[(E)-2-[2-[2-[(E)-2-(4-chlorophenyl)ethenyl]phenyl]phenyl]ethenyl]benzenesulfonic acid (PubChem CID 131989084) has the molecular formula C28H21ClO3S and a molecular weight of 472.99 g/mol. Its IUPAC name is 2-[(E)-2-[2-[2-[(E)-2-(4-chlorophenyl)ethenyl]phenyl]phenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 2-[(E)-2-[2-[2-[(E)-2-(4-chlorophenyl)ethenyl]phenyl]phenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 131989084 |
| Molecular Formula | C28H21ClO3S |
| Molecular Weight | 472.99 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 2-[(E)-2-[2-[2-[(E)-2-(4-chlorophenyl)ethenyl]phenyl]phenyl]ethenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccccc1/C=C/c1ccccc1-c1ccccc1/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H21ClO3S/c29-25-19-14-21(15-20-25)13-16-22-7-1-4-10-26(22)27-11-5-2-8-23(27)17-18-24-9-3-6-12-28(24)33(30,31)32/h1-20H,(H,30,31,32)/b16-13+,18-17+ |
| InChIKey | ZPGSGRVWPKRBKS-MTUSAYGMSA-N |
| XLogP | 7.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.99 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|