About 2-ethenylbenzenesulfonic acid
2-ethenylbenzenesulfonic acid (PubChem CID 161490655) has the molecular formula C16H16O6S2
and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-ethenylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 2-ethenylbenzenesulfonic acid |
| PubChem CID | 161490655 |
| Molecular Formula | C16H16O6S2 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 2-ethenylbenzenesulfonic acid |
| SMILES | C=Cc1ccccc1S(=O)(=O)O.C=Cc1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/2C8H8O3S/c2*1-2-7-5-3-4-6-8(7)12(9,10)11/h2*2-6H,1H2,(H,9,10,11) |
| InChIKey | WFOHBOFWFISWBS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylbenzenesulfonic acid?
The IUPAC name of 2-ethenylbenzenesulfonic acid (CID 161490655) is 2-ethenylbenzenesulfonic acid.
What is the SMILES notation for 2-ethenylbenzenesulfonic acid?
The canonical SMILES for 2-ethenylbenzenesulfonic acid is C=Cc1ccccc1S(=O)(=O)O.C=Cc1ccccc1S(=O)(=O)O.
What is the InChIKey of 2-ethenylbenzenesulfonic acid?
The InChIKey is WFOHBOFWFISWBS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H8O3S/c2*1-2-7-5-3-4-6-8(7)12(9,10)11/h2*2-6H,1H2,(H,9,10,11).
What are the key properties of 2-ethenylbenzenesulfonic acid?
2-ethenylbenzenesulfonic acid has a molecular weight of 368.43 g/mol, XLogP of 3.15, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylbenzenesulfonic acid is sourced from PubChem (CID 161490655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).