About 2-hydroxybenzenesulfonic acid;styrene
2-hydroxybenzenesulfonic acid;styrene (PubChem CID 175395013) has the molecular formula C14H14O4S
and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-hydroxybenzenesulfonic acid;styrene.
Molecular Properties
| Compound Name | 2-hydroxybenzenesulfonic acid;styrene |
| PubChem CID | 175395013 |
| Molecular Formula | C14H14O4S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-hydroxybenzenesulfonic acid;styrene |
| SMILES | C=Cc1ccccc1.O=S(=O)(O)c1ccccc1O |
| InChI | InChI=1S/C8H8.C6H6O4S/c1-2-8-6-4-3-5-7-8;7-5-3-1-2-4-6(5)11(8,9)10/h2-7H,1H2;1-4,7H,(H,8,9,10) |
| InChIKey | LCKPENHIWYFOTE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybenzenesulfonic acid;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzenesulfonic acid;styrene?
The IUPAC name of 2-hydroxybenzenesulfonic acid;styrene (CID 175395013) is 2-hydroxybenzenesulfonic acid;styrene.
What is the SMILES notation for 2-hydroxybenzenesulfonic acid;styrene?
The canonical SMILES for 2-hydroxybenzenesulfonic acid;styrene is C=Cc1ccccc1.O=S(=O)(O)c1ccccc1O.
What is the InChIKey of 2-hydroxybenzenesulfonic acid;styrene?
The InChIKey is LCKPENHIWYFOTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C6H6O4S/c1-2-8-6-4-3-5-7-8;7-5-3-1-2-4-6(5)11(8,9)10/h2-7H,1H2;1-4,7H,(H,8,9,10).
What are the key properties of 2-hydroxybenzenesulfonic acid;styrene?
2-hydroxybenzenesulfonic acid;styrene has a molecular weight of 278.33 g/mol, XLogP of 2.97, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzenesulfonic acid;styrene is sourced from PubChem (CID 175395013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).