About lithium;2-ethenylbenzenesulfonic acid;hydride
lithium;2-ethenylbenzenesulfonic acid;hydride (PubChem CID 173052957) has the molecular formula C8H9LiO3S
and a molecular weight of 192.17 g/mol. Its IUPAC name is lithium;2-ethenylbenzenesulfonic acid;hydride.
Molecular Properties
| Compound Name | lithium;2-ethenylbenzenesulfonic acid;hydride |
| PubChem CID | 173052957 |
| Molecular Formula | C8H9LiO3S |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | lithium;2-ethenylbenzenesulfonic acid;hydride |
| SMILES | C=Cc1ccccc1S(=O)(=O)O.[H-].[Li+] |
| InChI | InChI=1S/C8H8O3S.Li.H/c1-2-7-5-3-4-6-8(7)12(9,10)11;;/h2-6H,1H2,(H,9,10,11);;/q;+1;-1 |
| InChIKey | QPUXTJIOVPSGFG-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze lithium;2-ethenylbenzenesulfonic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;2-ethenylbenzenesulfonic acid;hydride?
The IUPAC name of lithium;2-ethenylbenzenesulfonic acid;hydride (CID 173052957) is lithium;2-ethenylbenzenesulfonic acid;hydride.
What is the SMILES notation for lithium;2-ethenylbenzenesulfonic acid;hydride?
The canonical SMILES for lithium;2-ethenylbenzenesulfonic acid;hydride is C=Cc1ccccc1S(=O)(=O)O.[H-].[Li+].
What is the InChIKey of lithium;2-ethenylbenzenesulfonic acid;hydride?
The InChIKey is QPUXTJIOVPSGFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3S.Li.H/c1-2-7-5-3-4-6-8(7)12(9,10)11;;/h2-6H,1H2,(H,9,10,11);;/q;+1;-1.
What are the key properties of lithium;2-ethenylbenzenesulfonic acid;hydride?
lithium;2-ethenylbenzenesulfonic acid;hydride has a molecular weight of 192.17 g/mol, XLogP of -1.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;2-ethenylbenzenesulfonic acid;hydride is sourced from PubChem (CID 173052957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).