C13H17NO5S — CID 88817180
2-ethenylbenzenesulfonic acid;2-(methoxymethyl)prop-2-enamide (PubChem CID 88817180) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-ethenylbenzenesulfonic acid;2-(methoxymethyl)prop-2-enamide.
| Compound Name | 2-ethenylbenzenesulfonic acid;2-(methoxymethyl)prop-2-enamide |
|---|---|
| PubChem CID | 88817180 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-ethenylbenzenesulfonic acid;2-(methoxymethyl)prop-2-enamide |
| SMILES | C=C(COC)C(N)=O.C=Cc1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C8H8O3S.C5H9NO2/c1-2-7-5-3-4-6-8(7)12(9,10)11;1-4(3-8-2)5(6)7/h2-6H,1H2,(H,9,10,11);1,3H2,2H3,(H2,6,7) |
| InChIKey | STCRKDHSVQJNPI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|