C11H15NNaO4S — CID 57369857
CID 57369857 (PubChem CID 57369857) has the molecular formula C11H15NNaO4S and a molecular weight of 280.30 g/mol.
| Compound Name | CID 57369857 |
|---|---|
| PubChem CID | 57369857 |
| Molecular Formula | C11H15NNaO4S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[N+]([O-])=Cc1ccccc1S(=O)(=O)O.[Na] |
| InChI | InChI=1S/C11H15NO4S.Na/c1-11(2,3)12(13)8-9-6-4-5-7-10(9)17(14,15)16;/h4-8H,1-3H3,(H,14,15,16); |
| InChIKey | DRXCOBCNEBETFZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|