C35H41NO4S — CID 88955516
N-tert-butyl-1-[4-methyl-3-[(E)-2-(8-methyl-5-propan-2-yl-3-sulfoazulen-1-yl)ethenyl]-7-propan-2-ylazulen-1-yl]methanimine oxide (PubChem CID 88955516) has the molecular formula C35H41NO4S and a molecular weight of 571.78 g/mol. Its IUPAC name is N-tert-butyl-1-[4-methyl-3-[(E)-2-(8-methyl-5-propan-2-yl-3-sulfoazulen-1-yl)ethenyl]-7-propan-2-ylazulen-1-yl]methanimine oxide.
| Compound Name | N-tert-butyl-1-[4-methyl-3-[(E)-2-(8-methyl-5-propan-2-yl-3-sulfoazulen-1-yl)ethenyl]-7-propan-2-ylazulen-1-yl]methanimine oxide |
|---|---|
| PubChem CID | 88955516 |
| Molecular Formula | C35H41NO4S |
| Molecular Weight | 571.78 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | N-tert-butyl-1-[4-methyl-3-[(E)-2-(8-methyl-5-propan-2-yl-3-sulfoazulen-1-yl)ethenyl]-7-propan-2-ylazulen-1-yl]methanimine oxide |
| SMILES | Cc1ccc(C(C)C)cc2c(/C=[N+](\[O-])C(C)(C)C)cc(/C=C/c3cc(S(=O)(=O)O)c4cc(C(C)C)ccc(C)c3-4)c1-2 |
| InChI | InChI=1S/C35H41NO4S/c1-21(2)25-12-10-23(5)33-27(16-29(30(33)17-25)20-36(37)35(7,8)9)14-15-28-19-32(41(38,39)40)31-18-26(22(3)4)13-11-24(6)34(28)31/h10-22H,1-9H3,(H,38,39,40)/b15-14+,36-20- |
| InChIKey | ALKDEFKMQOVGMK-MKHHQZPSSA-N |
| XLogP | 8.90 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.78 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|