C40H47NO3 — CID 88955515
N-tert-butyl-1-[3-[(E)-2-[3-[(E)-3-ethoxy-3-oxoprop-1-enyl]-8-methyl-5-propan-2-ylazulen-1-yl]ethenyl]-4-methyl-7-propan-2-ylazulen-1-yl]methanimine oxide (PubChem CID 88955515) has the molecular formula C40H47NO3 and a molecular weight of 589.82 g/mol. Its IUPAC name is N-tert-butyl-1-[3-[(E)-2-[3-[(E)-3-ethoxy-3-oxoprop-1-enyl]-8-methyl-5-propan-2-ylazulen-1-yl]ethenyl]-4-methyl-7-propan-2-ylazulen-1-yl]methanimine oxide.
| Compound Name | N-tert-butyl-1-[3-[(E)-2-[3-[(E)-3-ethoxy-3-oxoprop-1-enyl]-8-methyl-5-propan-2-ylazulen-1-yl]ethenyl]-4-methyl-7-propan-2-ylazulen-1-yl]methanimine oxide |
|---|---|
| PubChem CID | 88955515 |
| Molecular Formula | C40H47NO3 |
| Molecular Weight | 589.82 g/mol |
| Exact Mass | 589.36 |
| IUPAC Name | N-tert-butyl-1-[3-[(E)-2-[3-[(E)-3-ethoxy-3-oxoprop-1-enyl]-8-methyl-5-propan-2-ylazulen-1-yl]ethenyl]-4-methyl-7-propan-2-ylazulen-1-yl]methanimine oxide |
| SMILES | CCOC(=O)/C=C/c1cc(/C=C/c2cc(/C=[N+](\[O-])C(C)(C)C)c3cc(C(C)C)ccc(C)c2-3)c2c(C)ccc(C(C)C)cc1-2 |
| InChI | InChI=1S/C40H47NO3/c1-11-44-37(42)19-18-31-20-32(38-27(6)12-14-29(25(2)3)22-35(31)38)16-17-33-21-34(24-41(43)40(8,9)10)36-23-30(26(4)5)15-13-28(7)39(33)36/h12-26H,11H2,1-10H3/b17-16+,19-18+,41-24- |
| InChIKey | QKEFRCVWCSDEII-SWZXGRLMSA-N |
| XLogP | 10.23 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.82 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|