C17H19NO2 — CID 82580010
ethyl (E)-3-(2,5,8-trimethylquinolin-4-yl)prop-2-enoate (PubChem CID 82580010) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is ethyl (E)-3-(2,5,8-trimethylquinolin-4-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(2,5,8-trimethylquinolin-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 82580010 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | ethyl (E)-3-(2,5,8-trimethylquinolin-4-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(C)nc2c(C)ccc(C)c12 |
| InChI | InChI=1S/C17H19NO2/c1-5-20-15(19)9-8-14-10-13(4)18-17-12(3)7-6-11(2)16(14)17/h6-10H,5H2,1-4H3/b9-8+ |
| InChIKey | KCACSQFAWOZWNJ-CMDGGOBGSA-N |
| XLogP | 3.74 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|