C11H15N3O2 — CID 169480433
ethyl 3-(5,6-diamino-2-methyl-3-pyridinyl)prop-2-enoate (PubChem CID 169480433) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is ethyl 3-(5,6-diamino-2-methyl-3-pyridinyl)prop-2-enoate.
| Compound Name | ethyl 3-(5,6-diamino-2-methyl-3-pyridinyl)prop-2-enoate |
|---|---|
| PubChem CID | 169480433 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | ethyl 3-(5,6-diamino-2-methyl-3-pyridinyl)prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cc(N)c(N)nc1C |
| InChI | InChI=1S/C11H15N3O2/c1-3-16-10(15)5-4-8-6-9(12)11(13)14-7(8)2/h4-6H,3,12H2,1-2H3,(H2,13,14) |
| InChIKey | LAPDHSUZWCSTSF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|