C16H26N4O2 — CID 143641813
cyclohexane;ethyl (E)-3-(2,4-diamino-6-methylpyrimidin-5-yl)prop-2-enoate (PubChem CID 143641813) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is cyclohexane;ethyl (E)-3-(2,4-diamino-6-methylpyrimidin-5-yl)prop-2-enoate.
| Compound Name | cyclohexane;ethyl (E)-3-(2,4-diamino-6-methylpyrimidin-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 143641813 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | cyclohexane;ethyl (E)-3-(2,4-diamino-6-methylpyrimidin-5-yl)prop-2-enoate |
| SMILES | C1CCCCC1.CCOC(=O)/C=C/c1c(C)nc(N)nc1N |
| InChI | InChI=1S/C10H14N4O2.C6H12/c1-3-16-8(15)5-4-7-6(2)13-10(12)14-9(7)11;1-2-4-6-5-3-1/h4-5H,3H2,1-2H3,(H4,11,12,13,14);1-6H2/b5-4+; |
| InChIKey | AHZXQOPJBRVIQN-FXRZFVDSSA-N |
| XLogP | 2.87 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|