C10H12ClN3O3 — CID 170707726
ethyl (E)-3-(4-amino-2-chloro-6-methoxypyrimidin-5-yl)prop-2-enoate (PubChem CID 170707726) has the molecular formula C10H12ClN3O3 and a molecular weight of 257.68 g/mol. Its IUPAC name is ethyl (E)-3-(4-amino-2-chloro-6-methoxypyrimidin-5-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(4-amino-2-chloro-6-methoxypyrimidin-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 170707726 |
| Molecular Formula | C10H12ClN3O3 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | ethyl (E)-3-(4-amino-2-chloro-6-methoxypyrimidin-5-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c(N)nc(Cl)nc1OC |
| InChI | InChI=1S/C10H12ClN3O3/c1-3-17-7(15)5-4-6-8(12)13-10(11)14-9(6)16-2/h4-5H,3H2,1-2H3,(H2,12,13,14)/b5-4+ |
| InChIKey | HKOWNVCSHKGHQE-SNAWJCMRSA-N |
| XLogP | 1.30 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|