C15H19ClN6O4 — CID 157496465
3-chloro-6-methoxypyrazin-2-amine;ethyl (E)-3-(3-amino-5-methoxypyrazin-2-yl)prop-2-enoate (PubChem CID 157496465) has the molecular formula C15H19ClN6O4 and a molecular weight of 382.81 g/mol. Its IUPAC name is 3-chloro-6-methoxypyrazin-2-amine;ethyl (E)-3-(3-amino-5-methoxypyrazin-2-yl)prop-2-enoate.
| Compound Name | 3-chloro-6-methoxypyrazin-2-amine;ethyl (E)-3-(3-amino-5-methoxypyrazin-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 157496465 |
| Molecular Formula | C15H19ClN6O4 |
| Molecular Weight | 382.81 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 3-chloro-6-methoxypyrazin-2-amine;ethyl (E)-3-(3-amino-5-methoxypyrazin-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ncc(OC)nc1N.COc1cnc(Cl)c(N)n1 |
| InChI | InChI=1S/C10H13N3O3.C5H6ClN3O/c1-3-16-9(14)5-4-7-10(11)13-8(15-2)6-12-7;1-10-3-2-8-4(6)5(7)9-3/h4-6H,3H2,1-2H3,(H2,11,13);2H,1H3,(H2,7,9)/b5-4+; |
| InChIKey | BXWVIKFGTOCPBY-FXRZFVDSSA-N |
| XLogP | 1.36 |
| TPSA | 148.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.81 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|