C11H14ClN3O2 — CID 165386585
ethyl (E)-3-[4-chloro-2-methyl-6-(trideuteriomethylamino)pyrimidin-5-yl]prop-2-enoate (PubChem CID 165386585) has the molecular formula C11H14ClN3O2 and a molecular weight of 258.72 g/mol. Its IUPAC name is ethyl (E)-3-[4-chloro-2-methyl-6-(trideuteriomethylamino)pyrimidin-5-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-chloro-2-methyl-6-(trideuteriomethylamino)pyrimidin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 165386585 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 258.72 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | ethyl (E)-3-[4-chloro-2-methyl-6-(trideuteriomethylamino)pyrimidin-5-yl]prop-2-enoate |
| SMILES | [2H]C([2H])([2H])Nc1nc(C)nc(Cl)c1/C=C/C(=O)OCC |
| InChI | InChI=1S/C11H14ClN3O2/c1-4-17-9(16)6-5-8-10(12)14-7(2)15-11(8)13-3/h5-6H,4H2,1-3H3,(H,13,14,15)/b6-5+/i3D3 |
| InChIKey | QRHPFRLEEYQXNX-ZMCCERGKSA-N |
| XLogP | 2.06 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.72 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|