C17H26N2O3 — CID 135422936
N-tert-butyl-1-[3-[(Z)-[tert-butyl(oxido)azaniumylidene]methyl]-2-hydroxy-5-methylphenyl]methanimine oxide (PubChem CID 135422936) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-tert-butyl-1-[3-[(Z)-[tert-butyl(oxido)azaniumylidene]methyl]-2-hydroxy-5-methylphenyl]methanimine oxide.
| Compound Name | N-tert-butyl-1-[3-[(Z)-[tert-butyl(oxido)azaniumylidene]methyl]-2-hydroxy-5-methylphenyl]methanimine oxide |
|---|---|
| PubChem CID | 135422936 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-tert-butyl-1-[3-[(Z)-[tert-butyl(oxido)azaniumylidene]methyl]-2-hydroxy-5-methylphenyl]methanimine oxide |
| SMILES | Cc1cc(/C=[N+](\[O-])C(C)(C)C)c(O)c(/C=[N+](/[O-])C(C)(C)C)c1 |
| InChI | InChI=1S/C17H26N2O3/c1-12-8-13(10-18(21)16(2,3)4)15(20)14(9-12)11-19(22)17(5,6)7/h8-11,20H,1-7H3/b18-10-,19-11+ |
| InChIKey | QHGBLBNVWPJKIE-OMYAATJGSA-N |
| XLogP | 3.16 |
| TPSA | 72.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|