C19H31NO2 — CID 6294788
N-tert-butyl-1-(2,4-ditert-butyl-3-hydroxyphenyl)methanimine oxide (PubChem CID 6294788) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is N-tert-butyl-1-(2,4-ditert-butyl-3-hydroxyphenyl)methanimine oxide.
| Compound Name | N-tert-butyl-1-(2,4-ditert-butyl-3-hydroxyphenyl)methanimine oxide |
|---|---|
| PubChem CID | 6294788 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | N-tert-butyl-1-(2,4-ditert-butyl-3-hydroxyphenyl)methanimine oxide |
| SMILES | CC(C)(C)c1ccc(/C=[N+](\[O-])C(C)(C)C)c(C(C)(C)C)c1O |
| InChI | InChI=1S/C19H31NO2/c1-17(2,3)14-11-10-13(12-20(22)19(7,8)9)15(16(14)21)18(4,5)6/h10-12,21H,1-9H3/b20-12- |
| InChIKey | UENLIZGOGLIYMY-NDENLUEZSA-N |
| XLogP | 4.71 |
| TPSA | 46.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|