C32H50O2 — CID 141434807
2,6-ditert-butyl-3-[4-(2,4-ditert-butyl-3-hydroxyphenyl)butyl]phenol (PubChem CID 141434807) has the molecular formula C32H50O2 and a molecular weight of 466.75 g/mol. Its IUPAC name is 2,6-ditert-butyl-3-[4-(2,4-ditert-butyl-3-hydroxyphenyl)butyl]phenol.
| Compound Name | 2,6-ditert-butyl-3-[4-(2,4-ditert-butyl-3-hydroxyphenyl)butyl]phenol |
|---|---|
| PubChem CID | 141434807 |
| Molecular Formula | C32H50O2 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.38 |
| IUPAC Name | 2,6-ditert-butyl-3-[4-(2,4-ditert-butyl-3-hydroxyphenyl)butyl]phenol |
| SMILES | CC(C)(C)c1ccc(CCCCc2ccc(C(C)(C)C)c(O)c2C(C)(C)C)c(C(C)(C)C)c1O |
| InChI | InChI=1S/C32H50O2/c1-29(2,3)23-19-17-21(25(27(23)33)31(7,8)9)15-13-14-16-22-18-20-24(30(4,5)6)28(34)26(22)32(10,11)12/h17-20,33-34H,13-16H2,1-12H3 |
| InChIKey | JISRFBWKAANDIG-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|