C21H36O — CID 141294760
2,3-ditert-butyl-4-heptylphenol (PubChem CID 141294760) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is 2,3-ditert-butyl-4-heptylphenol.
| Compound Name | 2,3-ditert-butyl-4-heptylphenol |
|---|---|
| PubChem CID | 141294760 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | 2,3-ditert-butyl-4-heptylphenol |
| SMILES | CCCCCCCc1ccc(O)c(C(C)(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C21H36O/c1-8-9-10-11-12-13-16-14-15-17(22)19(21(5,6)7)18(16)20(2,3)4/h14-15,22H,8-13H2,1-7H3 |
| InChIKey | HEKWYMGREMFHBD-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|