C22H38O — CID 101292747
2,3-ditert-butyl-6-octylphenol (PubChem CID 101292747) has the molecular formula C22H38O and a molecular weight of 318.55 g/mol. Its IUPAC name is 2,3-ditert-butyl-6-octylphenol.
| Compound Name | 2,3-ditert-butyl-6-octylphenol |
|---|---|
| PubChem CID | 101292747 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | 2,3-ditert-butyl-6-octylphenol |
| SMILES | CCCCCCCCc1ccc(C(C)(C)C)c(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H38O/c1-8-9-10-11-12-13-14-17-15-16-18(21(2,3)4)19(20(17)23)22(5,6)7/h15-16,23H,8-14H2,1-7H3 |
| InChIKey | ZGJWXAQBIFWKIS-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|