C28H42O — CID 159042463
2-(2,5-ditert-butyl-4-octylphenyl)phenol (PubChem CID 159042463) has the molecular formula C28H42O and a molecular weight of 394.64 g/mol. Its IUPAC name is 2-(2,5-ditert-butyl-4-octylphenyl)phenol.
| Compound Name | 2-(2,5-ditert-butyl-4-octylphenyl)phenol |
|---|---|
| PubChem CID | 159042463 |
| Molecular Formula | C28H42O |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.32 |
| IUPAC Name | 2-(2,5-ditert-butyl-4-octylphenyl)phenol |
| SMILES | CCCCCCCCc1cc(C(C)(C)C)c(-c2ccccc2O)cc1C(C)(C)C |
| InChI | InChI=1S/C28H42O/c1-8-9-10-11-12-13-16-21-19-25(28(5,6)7)23(20-24(21)27(2,3)4)22-17-14-15-18-26(22)29/h14-15,17-20,29H,8-13,16H2,1-7H3 |
| InChIKey | JWFVJDLXJLFHQT-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|