About 2-(2-pentylphenyl)phenol
2-(2-pentylphenyl)phenol (PubChem CID 66866892) has the molecular formula C17H20O
and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-(2-pentylphenyl)phenol.
Molecular Properties
| Compound Name | 2-(2-pentylphenyl)phenol |
| PubChem CID | 66866892 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2-(2-pentylphenyl)phenol |
| SMILES | CCCCCc1ccccc1-c1ccccc1O |
| InChI | InChI=1S/C17H20O/c1-2-3-4-9-14-10-5-6-11-15(14)16-12-7-8-13-17(16)18/h5-8,10-13,18H,2-4,9H2,1H3 |
| InChIKey | GKZAUCNVVZPOER-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-pentylphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-pentylphenyl)phenol?
The IUPAC name of 2-(2-pentylphenyl)phenol (CID 66866892) is 2-(2-pentylphenyl)phenol.
What is the SMILES notation for 2-(2-pentylphenyl)phenol?
The canonical SMILES for 2-(2-pentylphenyl)phenol is CCCCCc1ccccc1-c1ccccc1O.
What is the InChIKey of 2-(2-pentylphenyl)phenol?
The InChIKey is GKZAUCNVVZPOER-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O/c1-2-3-4-9-14-10-5-6-11-15(14)16-12-7-8-13-17(16)18/h5-8,10-13,18H,2-4,9H2,1H3.
What are the key properties of 2-(2-pentylphenyl)phenol?
2-(2-pentylphenyl)phenol has a molecular weight of 240.35 g/mol, XLogP of 4.79, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-pentylphenyl)phenol is sourced from PubChem (CID 66866892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).